A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1013 |
PubChem ID | 235905 |
Hormone name | Allylestrenol |
Description | A synthetic steroid with progestational activity. |
Synonyms | allylestrenol Gestanin Gestanol Gestanon Gestanyn Orageston Organon Turinal Gestormone |
Molecular weight | 300.48 |
Molecular formula | C21H32O |
IUPAC Name | (8R,9S,10R,13S,14S,17R)-13-methyl-17-prop-2-enyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
Canonical smiles | CC12CCC3C(C1CCC2(CC=C)O)CCC4=CCCCC34 |
Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(CC=C)O)CCC4=CCCC[C@H]34
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | C12811 D01374   |
HMDB ID | N/A |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | DB01431 |
Drugpedia | wiki |
Receptor | N/A |
Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
References | Pubchem |